C27H17N3O6 — CID 91668210
3',6'-dihydroxy-2-[(E)-(2-nitrophenyl)methylideneamino]spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 91668210) has the molecular formula C27H17N3O6 and a molecular weight of 479.45 g/mol. Its IUPAC name is 3',6'-dihydroxy-2-[(E)-(2-nitrophenyl)methylideneamino]spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-dihydroxy-2-[(E)-(2-nitrophenyl)methylideneamino]spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 91668210 |
| Molecular Formula | C27H17N3O6 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 3',6'-dihydroxy-2-[(E)-(2-nitrophenyl)methylideneamino]spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | O=C1c2ccccc2C2(c3ccc(O)cc3Oc3cc(O)ccc32)N1/N=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H17N3O6/c31-17-9-11-21-24(13-17)36-25-14-18(32)10-12-22(25)27(21)20-7-3-2-6-19(20)26(33)29(27)28-15-16-5-1-4-8-23(16)30(34)35/h1-15,31-32H/b28-15+ |
| InChIKey | OCSTZQNROWLSPZ-RWPZCVJISA-N |
| XLogP | 4.89 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|