C24H15N3O4S — CID 172929280
3',6'-dihydroxy-2-[(E)-1,3-thiazol-2-ylmethylideneamino]spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 172929280) has the molecular formula C24H15N3O4S and a molecular weight of 441.47 g/mol. Its IUPAC name is 3',6'-dihydroxy-2-[(E)-1,3-thiazol-2-ylmethylideneamino]spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-dihydroxy-2-[(E)-1,3-thiazol-2-ylmethylideneamino]spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 172929280 |
| Molecular Formula | C24H15N3O4S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 3',6'-dihydroxy-2-[(E)-1,3-thiazol-2-ylmethylideneamino]spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | O=C1c2ccccc2C2(c3ccc(O)cc3Oc3cc(O)ccc32)N1/N=C/c1nccs1 |
| InChI | InChI=1S/C24H15N3O4S/c28-14-5-7-18-20(11-14)31-21-12-15(29)6-8-19(21)24(18)17-4-2-1-3-16(17)23(30)27(24)26-13-22-25-9-10-32-22/h1-13,28-29H/b26-13+ |
| InChIKey | ONDVRAQRHXYYQP-LGJNPRDNSA-N |
| XLogP | 4.44 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|