C34H36N5O2+ — CID 146168928
3',6'-bis(diethylamino)-2-[(E)-pyridin-1-ium-2-ylmethylideneamino]spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 146168928) has the molecular formula C34H36N5O2+ and a molecular weight of 546.70 g/mol. Its IUPAC name is 3',6'-bis(diethylamino)-2-[(E)-pyridin-1-ium-2-ylmethylideneamino]spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis(diethylamino)-2-[(E)-pyridin-1-ium-2-ylmethylideneamino]spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 146168928 |
| Molecular Formula | C34H36N5O2+ |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 3',6'-bis(diethylamino)-2-[(E)-pyridin-1-ium-2-ylmethylideneamino]spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1/N=C/c1cccc[nH+]1 |
| InChI | InChI=1S/C34H35N5O2/c1-5-37(6-2)25-16-18-29-31(21-25)41-32-22-26(38(7-3)8-4)17-19-30(32)34(29)28-15-10-9-14-27(28)33(40)39(34)36-23-24-13-11-12-20-35-24/h9-23H,5-8H2,1-4H3/p+1/b36-23+ |
| InChIKey | APANOTMHLDBMQU-GOJREDGKSA-O |
| XLogP | 6.08 |
| TPSA | 62.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|