C36H35N5O2 — CID 177419626
2-[(E)-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]iminomethyl]benzonitrile (PubChem CID 177419626) has the molecular formula C36H35N5O2 and a molecular weight of 569.71 g/mol. Its IUPAC name is 2-[(E)-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]iminomethyl]benzonitrile.
| Compound Name | 2-[(E)-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]iminomethyl]benzonitrile |
|---|---|
| PubChem CID | 177419626 |
| Molecular Formula | C36H35N5O2 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | 2-[(E)-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]iminomethyl]benzonitrile |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1/N=C/c1ccccc1C#N |
| InChI | InChI=1S/C36H35N5O2/c1-5-39(6-2)27-17-19-31-33(21-27)43-34-22-28(40(7-3)8-4)18-20-32(34)36(31)30-16-12-11-15-29(30)35(42)41(36)38-24-26-14-10-9-13-25(26)23-37/h9-22,24H,5-8H2,1-4H3/b38-24+ |
| InChIKey | YHVWMYCKECMZOR-RQXXSLPSSA-N |
| XLogP | 7.14 |
| TPSA | 72.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|