C39H38N4O2S — CID 177452374
3',6'-bis(diethylamino)-2-[(E)-(3-hydroxynaphthalen-2-yl)methylideneamino]spiro[isoindole-3,9'-xanthene]-1-thione (PubChem CID 177452374) has the molecular formula C39H38N4O2S and a molecular weight of 626.83 g/mol. Its IUPAC name is 3',6'-bis(diethylamino)-2-[(E)-(3-hydroxynaphthalen-2-yl)methylideneamino]spiro[isoindole-3,9'-xanthene]-1-thione.
| Compound Name | 3',6'-bis(diethylamino)-2-[(E)-(3-hydroxynaphthalen-2-yl)methylideneamino]spiro[isoindole-3,9'-xanthene]-1-thione |
|---|---|
| PubChem CID | 177452374 |
| Molecular Formula | C39H38N4O2S |
| Molecular Weight | 626.83 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | 3',6'-bis(diethylamino)-2-[(E)-(3-hydroxynaphthalen-2-yl)methylideneamino]spiro[isoindole-3,9'-xanthene]-1-thione |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=S)N1/N=C/c1cc2ccccc2cc1O |
| InChI | InChI=1S/C39H38N4O2S/c1-5-41(6-2)29-17-19-33-36(23-29)45-37-24-30(42(7-3)8-4)18-20-34(37)39(33)32-16-12-11-15-31(32)38(46)43(39)40-25-28-21-26-13-9-10-14-27(26)22-35(28)44/h9-25,44H,5-8H2,1-4H3/b40-25+ |
| InChIKey | XPWWUOMRKPYHDK-MYBYBSHWSA-N |
| XLogP | 8.66 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.83 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|