C40H39N5O3 — CID 137081554
3',6'-bis(diethylamino)-2-[6-[(2-hydroxyphenyl)methylideneamino]-2-pyridinyl]spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 137081554) has the molecular formula C40H39N5O3 and a molecular weight of 637.78 g/mol. Its IUPAC name is 3',6'-bis(diethylamino)-2-[6-[(2-hydroxyphenyl)methylideneamino]-2-pyridinyl]spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis(diethylamino)-2-[6-[(2-hydroxyphenyl)methylideneamino]-2-pyridinyl]spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 137081554 |
| Molecular Formula | C40H39N5O3 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.31 |
| IUPAC Name | 3',6'-bis(diethylamino)-2-[6-[(2-hydroxyphenyl)methylideneamino]-2-pyridinyl]spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1c1cccc(/N=C/c2ccccc2O)n1 |
| InChI | InChI=1S/C40H39N5O3/c1-5-43(6-2)28-20-22-32-35(24-28)48-36-25-29(44(7-3)8-4)21-23-33(36)40(32)31-16-11-10-15-30(31)39(47)45(40)38-19-13-18-37(42-38)41-26-27-14-9-12-17-34(27)46/h9-26,46H,5-8H2,1-4H3/b41-26+ |
| InChIKey | ZUCUBOGSMUTDGH-MMFILIDRSA-N |
| XLogP | 8.29 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|