C40H38N4O3 — CID 177498469
3',6'-bis(ethylamino)-2',7'-dimethyl-2-[(E)-(2-phenylmethoxyphenyl)methylideneamino]spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 177498469) has the molecular formula C40H38N4O3 and a molecular weight of 622.77 g/mol. Its IUPAC name is 3',6'-bis(ethylamino)-2',7'-dimethyl-2-[(E)-(2-phenylmethoxyphenyl)methylideneamino]spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis(ethylamino)-2',7'-dimethyl-2-[(E)-(2-phenylmethoxyphenyl)methylideneamino]spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 177498469 |
| Molecular Formula | C40H38N4O3 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | 3',6'-bis(ethylamino)-2',7'-dimethyl-2-[(E)-(2-phenylmethoxyphenyl)methylideneamino]spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCNc1cc2c(cc1C)C1(c3cc(C)c(NCC)cc3O2)c2ccccc2C(=O)N1/N=C/c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C40H38N4O3/c1-5-41-34-22-37-32(20-26(34)3)40(33-21-27(4)35(42-6-2)23-38(33)47-37)31-18-12-11-17-30(31)39(45)44(40)43-24-29-16-10-13-19-36(29)46-25-28-14-8-7-9-15-28/h7-24,41-42H,5-6,25H2,1-4H3/b43-24+ |
| InChIKey | ARNMXCRRSMNVKT-RWOOANICSA-N |
| XLogP | 8.63 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|