C35H38N4O3 — CID 91152059
2-[3-amino-1-(2-hydroxyphenyl)propyl]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 91152059) has the molecular formula C35H38N4O3 and a molecular weight of 562.71 g/mol. Its IUPAC name is 2-[3-amino-1-(2-hydroxyphenyl)propyl]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-[3-amino-1-(2-hydroxyphenyl)propyl]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 91152059 |
| Molecular Formula | C35H38N4O3 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 2-[3-amino-1-(2-hydroxyphenyl)propyl]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCNc1cc2c(cc1C)C1(c3cc(C)c(NCC)cc3O2)c2ccccc2C(=O)N1C(CCN)c1ccccc1O |
| InChI | InChI=1S/C35H38N4O3/c1-5-37-28-19-32-26(17-21(28)3)35(27-18-22(4)29(38-6-2)20-33(27)42-32)25-13-9-7-11-23(25)34(41)39(35)30(15-16-36)24-12-8-10-14-31(24)40/h7-14,17-20,30,37-38,40H,5-6,15-16,36H2,1-4H3 |
| InChIKey | JHIGMDZSXPFSGM-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|