C35H35N5O4S — CID 122402563
N-[[3',6'-bis(ethylamino)-2',7'-dimethyl-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]carbamothioyl]-4-methoxybenzamide (PubChem CID 122402563) has the molecular formula C35H35N5O4S and a molecular weight of 621.76 g/mol. Its IUPAC name is N-[[3',6'-bis(ethylamino)-2',7'-dimethyl-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | N-[[3',6'-bis(ethylamino)-2',7'-dimethyl-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 122402563 |
| Molecular Formula | C35H35N5O4S |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | N-[[3',6'-bis(ethylamino)-2',7'-dimethyl-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]carbamothioyl]-4-methoxybenzamide |
| SMILES | CCNc1cc2c(cc1C)C1(c3cc(C)c(NCC)cc3O2)c2ccccc2C(=O)N1NC(=S)NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C35H35N5O4S/c1-6-36-28-18-30-26(16-20(28)3)35(27-17-21(4)29(37-7-2)19-31(27)44-30)25-11-9-8-10-24(25)33(42)40(35)39-34(45)38-32(41)22-12-14-23(43-5)15-13-22/h8-19,36-37H,6-7H2,1-5H3,(H2,38,39,41,45) |
| InChIKey | HWPKKDYBADTFSR-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 103.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|