C17H15N3O3S — CID 11405099
4-methoxy-N-[(5-methyl-1,3-benzoxazol-2-yl)carbamothioyl]benzamide (PubChem CID 11405099) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is 4-methoxy-N-[(5-methyl-1,3-benzoxazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 4-methoxy-N-[(5-methyl-1,3-benzoxazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 11405099 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 4-methoxy-N-[(5-methyl-1,3-benzoxazol-2-yl)carbamothioyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2nc3cc(C)ccc3o2)cc1 |
| InChI | InChI=1S/C17H15N3O3S/c1-10-3-8-14-13(9-10)18-16(23-14)20-17(24)19-15(21)11-4-6-12(22-2)7-5-11/h3-9H,1-2H3,(H2,18,19,20,21,24) |
| InChIKey | GUXSVWNGULDEHI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|