C47H51N9O2 — CID 102502096
2-[[4,6-bis(2,4-dimethylanilino)-1,3,5-triazin-2-yl]amino]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 102502096) has the molecular formula C47H51N9O2 and a molecular weight of 773.99 g/mol. Its IUPAC name is 2-[[4,6-bis(2,4-dimethylanilino)-1,3,5-triazin-2-yl]amino]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-[[4,6-bis(2,4-dimethylanilino)-1,3,5-triazin-2-yl]amino]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 102502096 |
| Molecular Formula | C47H51N9O2 |
| Molecular Weight | 773.99 g/mol |
| Exact Mass | 773.42 |
| IUPAC Name | 2-[[4,6-bis(2,4-dimethylanilino)-1,3,5-triazin-2-yl]amino]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1Nc1nc(Nc2ccc(C)cc2C)nc(Nc2ccc(C)cc2C)n1 |
| InChI | InChI=1S/C47H51N9O2/c1-9-54(10-2)33-19-21-37-41(27-33)58-42-28-34(55(11-3)12-4)20-22-38(42)47(37)36-16-14-13-15-35(36)43(57)56(47)53-46-51-44(48-39-23-17-29(5)25-31(39)7)50-45(52-46)49-40-24-18-30(6)26-32(40)8/h13-28H,9-12H2,1-8H3,(H3,48,49,50,51,52,53) |
| InChIKey | LHKWLVCWQDTOER-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.99 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|