C36H38N4O4 — CID 102431810
N-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]-3-cyclopenta-1,3-dien-1-yl-3-oxopropanamide (PubChem CID 102431810) has the molecular formula C36H38N4O4 and a molecular weight of 590.72 g/mol. Its IUPAC name is N-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]-3-cyclopenta-1,3-dien-1-yl-3-oxopropanamide.
| Compound Name | N-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]-3-cyclopenta-1,3-dien-1-yl-3-oxopropanamide |
|---|---|
| PubChem CID | 102431810 |
| Molecular Formula | C36H38N4O4 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | N-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]-3-cyclopenta-1,3-dien-1-yl-3-oxopropanamide |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1NC(=O)CC(=O)C1=CC=CC1 |
| InChI | InChI=1S/C36H38N4O4/c1-5-38(6-2)25-17-19-29-32(21-25)44-33-22-26(39(7-3)8-4)18-20-30(33)36(29)28-16-12-11-15-27(28)35(43)40(36)37-34(42)23-31(41)24-13-9-10-14-24/h9-13,15-22H,5-8,14,23H2,1-4H3,(H,37,42) |
| InChIKey | AXTKSDRKUMNOJT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|