C33H35N5O3 — CID 78426147
[3,8-bis(diethylamino)-3'-oxospiro[benzo[b]xanthene-12,1'-isoindole]-2'-yl]urea (PubChem CID 78426147) has the molecular formula C33H35N5O3 and a molecular weight of 549.68 g/mol. Its IUPAC name is [3,8-bis(diethylamino)-3'-oxospiro[benzo[b]xanthene-12,1'-isoindole]-2'-yl]urea.
| Compound Name | [3,8-bis(diethylamino)-3'-oxospiro[benzo[b]xanthene-12,1'-isoindole]-2'-yl]urea |
|---|---|
| PubChem CID | 78426147 |
| Molecular Formula | C33H35N5O3 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | [3,8-bis(diethylamino)-3'-oxospiro[benzo[b]xanthene-12,1'-isoindole]-2'-yl]urea |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc3cc(N(CC)CC)ccc3cc1C21c2ccccc2C(=O)N1NC(N)=O |
| InChI | InChI=1S/C33H35N5O3/c1-5-36(6-2)23-14-13-21-18-28-29(19-22(21)17-23)41-30-20-24(37(7-3)8-4)15-16-27(30)33(28)26-12-10-9-11-25(26)31(39)38(33)35-32(34)40/h9-20H,5-8H2,1-4H3,(H3,34,35,40) |
| InChIKey | LHEMFJJGDYBSKJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |