C34H34N4O3 — CID 177452130
3',6'-bis(ethylamino)-2-[(E)-1-(4-hydroxyphenyl)ethylideneamino]-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 177452130) has the molecular formula C34H34N4O3 and a molecular weight of 546.67 g/mol. Its IUPAC name is 3',6'-bis(ethylamino)-2-[(E)-1-(4-hydroxyphenyl)ethylideneamino]-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis(ethylamino)-2-[(E)-1-(4-hydroxyphenyl)ethylideneamino]-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 177452130 |
| Molecular Formula | C34H34N4O3 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 3',6'-bis(ethylamino)-2-[(E)-1-(4-hydroxyphenyl)ethylideneamino]-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCNc1cc2c(cc1C)C1(c3cc(C)c(NCC)cc3O2)c2ccccc2C(=O)N1/N=C(\C)c1ccc(O)cc1 |
| InChI | InChI=1S/C34H34N4O3/c1-6-35-29-18-31-27(16-20(29)3)34(28-17-21(4)30(36-7-2)19-32(28)41-31)26-11-9-8-10-25(26)33(40)38(34)37-22(5)23-12-14-24(39)15-13-23/h8-19,35-36,39H,6-7H2,1-5H3/b37-22+ |
| InChIKey | BWGJHZPDVZGGPB-SEBMTOOBSA-N |
| XLogP | 7.15 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|