C34H40N4O2 — CID 118017139
2-[2-[bis(prop-2-enyl)amino]ethyl]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 118017139) has the molecular formula C34H40N4O2 and a molecular weight of 536.72 g/mol. Its IUPAC name is 2-[2-[bis(prop-2-enyl)amino]ethyl]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-[2-[bis(prop-2-enyl)amino]ethyl]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 118017139 |
| Molecular Formula | C34H40N4O2 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | 2-[2-[bis(prop-2-enyl)amino]ethyl]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | C=CCN(CC=C)CCN1C(=O)c2ccccc2C12c1cc(C)c(NCC)cc1Oc1cc(NCC)c(C)cc12 |
| InChI | InChI=1S/C34H40N4O2/c1-7-15-37(16-8-2)17-18-38-33(39)25-13-11-12-14-26(25)34(38)27-19-23(5)29(35-9-3)21-31(27)40-32-22-30(36-10-4)24(6)20-28(32)34/h7-8,11-14,19-22,35-36H,1-2,9-10,15-18H2,3-6H3 |
| InChIKey | VERXXMRHNWMXLD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|