C34H37N5O2 — CID 118971821
3',6'-bis(ethylamino)-2'-methyl-2-propyl-7'-(1H-pyrrol-2-ylmethyliminomethyl)spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 118971821) has the molecular formula C34H37N5O2 and a molecular weight of 547.70 g/mol. Its IUPAC name is 3',6'-bis(ethylamino)-2'-methyl-2-propyl-7'-(1H-pyrrol-2-ylmethyliminomethyl)spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis(ethylamino)-2'-methyl-2-propyl-7'-(1H-pyrrol-2-ylmethyliminomethyl)spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 118971821 |
| Molecular Formula | C34H37N5O2 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | 3',6'-bis(ethylamino)-2'-methyl-2-propyl-7'-(1H-pyrrol-2-ylmethyliminomethyl)spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCCN1C(=O)c2ccccc2C12c1cc(C)c(NCC)cc1Oc1cc(NCC)c(/C=N/Cc3ccc[nH]3)cc12 |
| InChI | InChI=1S/C34H37N5O2/c1-5-15-39-33(40)25-12-8-9-13-26(25)34(39)27-16-22(4)29(36-6-2)18-31(27)41-32-19-30(37-7-3)23(17-28(32)34)20-35-21-24-11-10-14-38-24/h8-14,16-20,36-38H,5-7,15,21H2,1-4H3/b35-20+ |
| InChIKey | NCQRGEUWUVNWJE-JEPNHJGPSA-N |
| XLogP | 7.07 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|