C33H32N4O3 — CID 102580042
3',6'-bis(ethylamino)-2',7'-dimethyl-3-oxo-N-phenylspiro[isoindole-1,9'-xanthene]-2-carboxamide (PubChem CID 102580042) has the molecular formula C33H32N4O3 and a molecular weight of 532.64 g/mol. Its IUPAC name is 3',6'-bis(ethylamino)-2',7'-dimethyl-3-oxo-N-phenylspiro[isoindole-1,9'-xanthene]-2-carboxamide.
| Compound Name | 3',6'-bis(ethylamino)-2',7'-dimethyl-3-oxo-N-phenylspiro[isoindole-1,9'-xanthene]-2-carboxamide |
|---|---|
| PubChem CID | 102580042 |
| Molecular Formula | C33H32N4O3 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 3',6'-bis(ethylamino)-2',7'-dimethyl-3-oxo-N-phenylspiro[isoindole-1,9'-xanthene]-2-carboxamide |
| SMILES | CCNc1cc2c(cc1C)C1(c3cc(C)c(NCC)cc3O2)c2ccccc2C(=O)N1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C33H32N4O3/c1-5-34-27-18-29-25(16-20(27)3)33(26-17-21(4)28(35-6-2)19-30(26)40-29)24-15-11-10-14-23(24)31(38)37(33)32(39)36-22-12-8-7-9-13-22/h7-19,34-35H,5-6H2,1-4H3,(H,36,39) |
| InChIKey | PFNIBRRQEUVEEN-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|