C32H32ClN3O — CID 72700813
2-(4-chlorophenyl)-3-N',6-N'-diethyl-2',7'-dimethylspiro[1H-isoindole-3,9'-xanthene]-3',6'-diamine (PubChem CID 72700813) has the molecular formula C32H32ClN3O and a molecular weight of 510.08 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-N',6-N'-diethyl-2',7'-dimethylspiro[1H-isoindole-3,9'-xanthene]-3',6'-diamine.
| Compound Name | 2-(4-chlorophenyl)-3-N',6-N'-diethyl-2',7'-dimethylspiro[1H-isoindole-3,9'-xanthene]-3',6'-diamine |
|---|---|
| PubChem CID | 72700813 |
| Molecular Formula | C32H32ClN3O |
| Molecular Weight | 510.08 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 2-(4-chlorophenyl)-3-N',6-N'-diethyl-2',7'-dimethylspiro[1H-isoindole-3,9'-xanthene]-3',6'-diamine |
| SMILES | CCNc1cc2c(cc1C)C1(c3ccccc3CN1c1ccc(Cl)cc1)c1cc(C)c(NCC)cc1O2 |
| InChI | InChI=1S/C32H32ClN3O/c1-5-34-28-17-30-26(15-20(28)3)32(27-16-21(4)29(35-6-2)18-31(27)37-30)25-10-8-7-9-22(25)19-36(32)24-13-11-23(33)12-14-24/h7-18,34-35H,5-6,19H2,1-4H3 |
| InChIKey | JWPBWOAZBZYANB-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.08 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|