C42H48N10O2 — CID 123258828
2-[[1-[2-[3-[bis(prop-2-ynyl)amino]-2-diazenylpropyl]iminoethyl]triazol-4-yl]methyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 123258828) has the molecular formula C42H48N10O2 and a molecular weight of 724.91 g/mol. Its IUPAC name is 2-[[1-[2-[3-[bis(prop-2-ynyl)amino]-2-diazenylpropyl]iminoethyl]triazol-4-yl]methyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-[[1-[2-[3-[bis(prop-2-ynyl)amino]-2-diazenylpropyl]iminoethyl]triazol-4-yl]methyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 123258828 |
| Molecular Formula | C42H48N10O2 |
| Molecular Weight | 724.91 g/mol |
| Exact Mass | 724.40 |
| IUPAC Name | 2-[[1-[2-[3-[bis(prop-2-ynyl)amino]-2-diazenylpropyl]iminoethyl]triazol-4-yl]methyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | [H]/N=N/C(C/N=C/Cn1cc(CN2C(=O)c3ccccc3C23c2ccc(N(CC)CC)cc2Oc2cc(N(CC)CC)ccc23)nn1)CN(CC#C)CC#C |
| InChI | InChI=1S/C42H48N10O2/c1-7-22-48(23-8-2)28-31(45-43)27-44-21-24-51-29-32(46-47-51)30-52-41(53)35-15-13-14-16-36(35)42(52)37-19-17-33(49(9-3)10-4)25-39(37)54-40-26-34(18-20-38(40)42)50(11-5)12-6/h1-2,13-21,25-26,29,31,43H,9-12,22-24,27-28,30H2,3-6H3/b44-21+,45-43+ |
| InChIKey | LTPGRZYPDHUPLY-GPLBVAJLSA-N |
| XLogP | 6.06 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.91 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|