C40H48ClN3O5 — CID 141471256
6-[3,6-bis(azetidin-1-yl)-10,10-dimethyl-1H-anthracen-1-ylium-9-ylidene]-4-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyl]cyclohexa-2,4-diene-1-carboxylate (PubChem CID 141471256) has the molecular formula C40H48ClN3O5 and a molecular weight of 686.29 g/mol. Its IUPAC name is 6-[3,6-bis(azetidin-1-yl)-10,10-dimethyl-1H-anthracen-1-ylium-9-ylidene]-4-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyl]cyclohexa-2,4-diene-1-carboxylate.
| Compound Name | 6-[3,6-bis(azetidin-1-yl)-10,10-dimethyl-1H-anthracen-1-ylium-9-ylidene]-4-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyl]cyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 141471256 |
| Molecular Formula | C40H48ClN3O5 |
| Molecular Weight | 686.29 g/mol |
| Exact Mass | 685.33 |
| IUPAC Name | 6-[3,6-bis(azetidin-1-yl)-10,10-dimethyl-1H-anthracen-1-ylium-9-ylidene]-4-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyl]cyclohexa-2,4-diene-1-carboxylate |
| SMILES | CC1(C)C2=C([C+]=CC(N3CCC3)=C2)C(=C2C=C(C(=O)NCCOCCOCCCCCCCl)C=CC2C(=O)[O-])c2ccc(N3CCC3)cc21 |
| InChI | InChI=1S/C40H48ClN3O5/c1-40(2)35-26-29(43-17-7-18-43)10-13-32(35)37(33-14-11-30(27-36(33)40)44-19-8-20-44)34-25-28(9-12-31(34)39(46)47)38(45)42-16-22-49-24-23-48-21-6-4-3-5-15-41/h9-13,25-27,31H,3-8,15-24H2,1-2H3,(H-,42,45,46,47) |
| InChIKey | BBPYLCODNXPXMW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.29 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|