C48H50ClF3N3O5+ — CID 159558404
4-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyl]-2-[10,10-dimethyl-3,6-bis(N-methylanilino)anthracen-9-ylium-9-yl]-3,5,6-trifluorobenzoic acid (PubChem CID 159558404) has the molecular formula C48H50ClF3N3O5+ and a molecular weight of 841.39 g/mol. Its IUPAC name is 4-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyl]-2-[10,10-dimethyl-3,6-bis(N-methylanilino)anthracen-9-ylium-9-yl]-3,5,6-trifluorobenzoic acid.
| Compound Name | 4-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyl]-2-[10,10-dimethyl-3,6-bis(N-methylanilino)anthracen-9-ylium-9-yl]-3,5,6-trifluorobenzoic acid |
|---|---|
| PubChem CID | 159558404 |
| Molecular Formula | C48H50ClF3N3O5+ |
| Molecular Weight | 841.39 g/mol |
| Exact Mass | 840.34 |
| IUPAC Name | 4-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyl]-2-[10,10-dimethyl-3,6-bis(N-methylanilino)anthracen-9-ylium-9-yl]-3,5,6-trifluorobenzoic acid |
| SMILES | CN(c1ccccc1)c1ccc2c(c1)C(C)(C)c1cc(N(C)c3ccccc3)ccc1[C+]2c1c(F)c(C(=O)NCCOCCOCCCCCCCl)c(F)c(F)c1C(=O)O |
| InChI | InChI=1S/C48H49ClF3N3O5/c1-48(2)37-29-33(54(3)31-15-9-7-10-16-31)19-21-35(37)39(36-22-20-34(30-38(36)48)55(4)32-17-11-8-12-18-32)40-41(47(57)58)44(51)45(52)42(43(40)50)46(56)53-24-26-60-28-27-59-25-14-6-5-13-23-49/h7-12,15-22,29-30H,5-6,13-14,23-28H2,1-4H3,(H-,53,56,57,58)/p+1 |
| InChIKey | MGHDFRHRBOIJIJ-UHFFFAOYSA-O |
| XLogP | 10.56 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.39 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|