C28H41ClN2O3 — CID 75972519
1-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3-(3-methyl-1,1-diphenylbutan-2-yl)urea (PubChem CID 75972519) has the molecular formula C28H41ClN2O3 and a molecular weight of 489.10 g/mol. Its IUPAC name is 1-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3-(3-methyl-1,1-diphenylbutan-2-yl)urea.
| Compound Name | 1-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3-(3-methyl-1,1-diphenylbutan-2-yl)urea |
|---|---|
| PubChem CID | 75972519 |
| Molecular Formula | C28H41ClN2O3 |
| Molecular Weight | 489.10 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 1-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3-(3-methyl-1,1-diphenylbutan-2-yl)urea |
| SMILES | CC(C)C(NC(=O)NCCOCCOCCCCCCCl)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H41ClN2O3/c1-23(2)27(26(24-13-7-5-8-14-24)25-15-9-6-10-16-25)31-28(32)30-18-20-34-22-21-33-19-12-4-3-11-17-29/h5-10,13-16,23,26-27H,3-4,11-12,17-22H2,1-2H3,(H2,30,31,32) |
| InChIKey | SCJYSGJQOICTPH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.10 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|