C20H29ClF3NO3 — CID 129057530
(2S)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3,3,3-trifluoro-2-methyl-2-phenylpropanamide (PubChem CID 129057530) has the molecular formula C20H29ClF3NO3 and a molecular weight of 423.90 g/mol. Its IUPAC name is (2S)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3,3,3-trifluoro-2-methyl-2-phenylpropanamide.
| Compound Name | (2S)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3,3,3-trifluoro-2-methyl-2-phenylpropanamide |
|---|---|
| PubChem CID | 129057530 |
| Molecular Formula | C20H29ClF3NO3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (2S)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-3,3,3-trifluoro-2-methyl-2-phenylpropanamide |
| SMILES | C[C@@](C(=O)NCCOCCOCCCCCCCl)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H29ClF3NO3/c1-19(20(22,23)24,17-9-5-4-6-10-17)18(26)25-12-14-28-16-15-27-13-8-3-2-7-11-21/h4-6,9-10H,2-3,7-8,11-16H2,1H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | RPRQBCOAUMQRNU-IBGZPJMESA-N |
| XLogP | 4.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|