C12H14ClF3N2O — CID 57218547
1-(2-chloroethyl)-3-(1,1,1-trifluoro-2-phenylpropan-2-yl)urea (PubChem CID 57218547) has the molecular formula C12H14ClF3N2O and a molecular weight of 294.70 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-(1,1,1-trifluoro-2-phenylpropan-2-yl)urea.
| Compound Name | 1-(2-chloroethyl)-3-(1,1,1-trifluoro-2-phenylpropan-2-yl)urea |
|---|---|
| PubChem CID | 57218547 |
| Molecular Formula | C12H14ClF3N2O |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 1-(2-chloroethyl)-3-(1,1,1-trifluoro-2-phenylpropan-2-yl)urea |
| SMILES | CC(NC(=O)NCCCl)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H14ClF3N2O/c1-11(12(14,15)16,9-5-3-2-4-6-9)18-10(19)17-8-7-13/h2-6H,7-8H2,1H3,(H2,17,18,19) |
| InChIKey | XQUBJNZKKBYKDH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|