C17H27ClN2O — CID 10041094
1-(2-chloroethyl)-3-(2,5-ditert-butylphenyl)urea (PubChem CID 10041094) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-(2,5-ditert-butylphenyl)urea.
| Compound Name | 1-(2-chloroethyl)-3-(2,5-ditert-butylphenyl)urea |
|---|---|
| PubChem CID | 10041094 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-(2-chloroethyl)-3-(2,5-ditert-butylphenyl)urea |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(NC(=O)NCCCl)c1 |
| InChI | InChI=1S/C17H27ClN2O/c1-16(2,3)12-7-8-13(17(4,5)6)14(11-12)20-15(21)19-10-9-18/h7-8,11H,9-10H2,1-6H3,(H2,19,20,21) |
| InChIKey | JGELTYLRYQSBLO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|