C19H30N2O4S — CID 164641176
1-(2,5-ditert-butylphenyl)-3-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]urea (PubChem CID 164641176) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-(2,5-ditert-butylphenyl)-3-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]urea.
| Compound Name | 1-(2,5-ditert-butylphenyl)-3-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 164641176 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-(2,5-ditert-butylphenyl)-3-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]urea |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(NC(=O)N[C@H]2CS(=O)(=O)C[C@@H]2O)c1 |
| InChI | InChI=1S/C19H30N2O4S/c1-18(2,3)12-7-8-13(19(4,5)6)14(9-12)20-17(23)21-15-10-26(24,25)11-16(15)22/h7-9,15-16,22H,10-11H2,1-6H3,(H2,20,21,23)/t15-,16-/m0/s1 |
| InChIKey | QUTHKUOKDMMOIL-HOTGVXAUSA-N |
| XLogP | 2.56 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |