C22H25NO7S — CID 41010435
2-(3-tert-butyl-5-methyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 41010435) has the molecular formula C22H25NO7S and a molecular weight of 447.51 g/mol. Its IUPAC name is 2-(3-tert-butyl-5-methyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-(3-tert-butyl-5-methyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 41010435 |
| Molecular Formula | C22H25NO7S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2-(3-tert-butyl-5-methyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | Cc1c(CC(=O)N[C@@H]2CS(=O)(=O)C[C@@H]2O)c(=O)oc2cc3occ(C(C)(C)C)c3cc12 |
| InChI | InChI=1S/C22H25NO7S/c1-11-12-5-14-15(22(2,3)4)8-29-18(14)7-19(12)30-21(26)13(11)6-20(25)23-16-9-31(27,28)10-17(16)24/h5,7-8,16-17,24H,6,9-10H2,1-4H3,(H,23,25)/t16-,17+/m1/s1 |
| InChIKey | XKXWPWPPCOORKR-SJORKVTESA-N |
| XLogP | 1.96 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|