C23H25NO7S — CID 40899779
2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 40899779) has the molecular formula C23H25NO7S and a molecular weight of 459.52 g/mol. Its IUPAC name is 2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 40899779 |
| Molecular Formula | C23H25NO7S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | Cc1c(CC(=O)N[C@@H]2CS(=O)(=O)C[C@H]2O)c(=O)oc2c(C)c3oc4c(c3cc12)CCCC4 |
| InChI | InChI=1S/C23H25NO7S/c1-11-14-7-16-13-5-3-4-6-19(13)30-22(16)12(2)21(14)31-23(27)15(11)8-20(26)24-17-9-32(28,29)10-18(17)25/h7,17-18,25H,3-6,8-10H2,1-2H3,(H,24,26)/t17-,18-/m1/s1 |
| InChIKey | PKGMIPKHHTWFMG-QZTJIDSGSA-N |
| XLogP | 1.85 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|