C25H33N2O4+ — CID 7096664
3-[3-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)propanoylamino]propyl-dimethylazanium (PubChem CID 7096664) has the molecular formula C25H33N2O4+ and a molecular weight of 425.55 g/mol. Its IUPAC name is 3-[3-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)propanoylamino]propyl-dimethylazanium.
| Compound Name | 3-[3-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)propanoylamino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7096664 |
| Molecular Formula | C25H33N2O4+ |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 3-[3-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)propanoylamino]propyl-dimethylazanium |
| SMILES | Cc1c(CCC(=O)NCCC[NH+](C)C)c(=O)oc2c(C)c3oc4c(c3cc12)CCCC4 |
| InChI | InChI=1S/C25H32N2O4/c1-15-17(10-11-22(28)26-12-7-13-27(3)4)25(29)31-23-16(2)24-20(14-19(15)23)18-8-5-6-9-21(18)30-24/h14H,5-13H2,1-4H3,(H,26,28)/p+1 |
| InChIKey | XLXUOJXUPBADJR-UHFFFAOYSA-O |
| XLogP | 2.62 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|