C32H34N2O7S — CID 73399959
3-[[3-benzylsulfanyl-2-[[2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetyl]amino]propanoyl]amino]propanoic acid (PubChem CID 73399959) has the molecular formula C32H34N2O7S and a molecular weight of 590.70 g/mol. Its IUPAC name is 3-[[3-benzylsulfanyl-2-[[2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetyl]amino]propanoyl]amino]propanoic acid.
| Compound Name | 3-[[3-benzylsulfanyl-2-[[2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetyl]amino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 73399959 |
| Molecular Formula | C32H34N2O7S |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | 3-[[3-benzylsulfanyl-2-[[2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetyl]amino]propanoyl]amino]propanoic acid |
| SMILES | Cc1c(CC(=O)NC(CSCc2ccccc2)C(=O)NCCC(=O)O)c(=O)oc2c(C)c3oc4c(c3cc12)CCCC4 |
| InChI | InChI=1S/C32H34N2O7S/c1-18-22-14-24-21-10-6-7-11-26(21)40-30(24)19(2)29(22)41-32(39)23(18)15-27(35)34-25(31(38)33-13-12-28(36)37)17-42-16-20-8-4-3-5-9-20/h3-5,8-9,14,25H,6-7,10-13,15-17H2,1-2H3,(H,33,38)(H,34,35)(H,36,37) |
| InChIKey | XLGWLAWFBNTEJV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|