C22H23NO6 — CID 6851189
(2S)-2-[[2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetyl]amino]propanoic acid (PubChem CID 6851189) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is (2S)-2-[[2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 6851189 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (2S)-2-[[2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetyl]amino]propanoic acid |
| SMILES | Cc1c(CC(=O)N[C@@H](C)C(=O)O)c(=O)oc2c(C)c3oc4c(c3cc12)CCCC4 |
| InChI | InChI=1S/C22H23NO6/c1-10-14-8-16-13-6-4-5-7-17(13)28-20(16)11(2)19(14)29-22(27)15(10)9-18(24)23-12(3)21(25)26/h8,12H,4-7,9H2,1-3H3,(H,23,24)(H,25,26)/t12-/m0/s1 |
| InChIKey | JBBWJTWWKIIEMQ-LBPRGKRZSA-N |
| XLogP | 3.17 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|