C24H20BrNO6 — CID 177429749
(2R)-2-[[2-[3-(4-bromophenyl)-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl]acetyl]amino]propanoic acid (PubChem CID 177429749) has the molecular formula C24H20BrNO6 and a molecular weight of 498.33 g/mol. Its IUPAC name is (2R)-2-[[2-[3-(4-bromophenyl)-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl]acetyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[2-[3-(4-bromophenyl)-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 177429749 |
| Molecular Formula | C24H20BrNO6 |
| Molecular Weight | 498.33 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | (2R)-2-[[2-[3-(4-bromophenyl)-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl]acetyl]amino]propanoic acid |
| SMILES | Cc1c(CC(=O)N[C@H](C)C(=O)O)c(=O)oc2c(C)c3occ(-c4ccc(Br)cc4)c3cc12 |
| InChI | InChI=1S/C24H20BrNO6/c1-11-16-8-18-19(14-4-6-15(25)7-5-14)10-31-21(18)12(2)22(16)32-24(30)17(11)9-20(27)26-13(3)23(28)29/h4-8,10,13H,9H2,1-3H3,(H,26,27)(H,28,29)/t13-/m1/s1 |
| InChIKey | WOSJZHZLHPVUAD-CYBMUJFWSA-N |
| XLogP | 4.72 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.33 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|