C30H24ClNO6 — CID 5157015
2-[[2-[3-(4-chlorophenyl)-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 5157015) has the molecular formula C30H24ClNO6 and a molecular weight of 529.98 g/mol. Its IUPAC name is 2-[[2-[3-(4-chlorophenyl)-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[3-(4-chlorophenyl)-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 5157015 |
| Molecular Formula | C30H24ClNO6 |
| Molecular Weight | 529.98 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 2-[[2-[3-(4-chlorophenyl)-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | Cc1c(CC(=O)NC(Cc2ccccc2)C(=O)O)c(=O)oc2c(C)c3occ(-c4ccc(Cl)cc4)c3cc12 |
| InChI | InChI=1S/C30H24ClNO6/c1-16-21-13-23-24(19-8-10-20(31)11-9-19)15-37-27(23)17(2)28(21)38-30(36)22(16)14-26(33)32-25(29(34)35)12-18-6-4-3-5-7-18/h3-11,13,15,25H,12,14H2,1-2H3,(H,32,33)(H,34,35) |
| InChIKey | NRBQYDIPDIGVRZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.98 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|