C30H24ClNO6 — CID 3799317
3-(4-chlorophenyl)-2-[[2-(2,5-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]amino]propanoic acid (PubChem CID 3799317) has the molecular formula C30H24ClNO6 and a molecular weight of 529.98 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-[[2-(2,5-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]amino]propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-2-[[2-(2,5-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 3799317 |
| Molecular Formula | C30H24ClNO6 |
| Molecular Weight | 529.98 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 3-(4-chlorophenyl)-2-[[2-(2,5-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]amino]propanoic acid |
| SMILES | Cc1oc2cc3oc(=O)c(CC(=O)NC(Cc4ccc(Cl)cc4)C(=O)O)c(C)c3cc2c1-c1ccccc1 |
| InChI | InChI=1S/C30H24ClNO6/c1-16-21-13-23-26(37-17(2)28(23)19-6-4-3-5-7-19)15-25(21)38-30(36)22(16)14-27(33)32-24(29(34)35)12-18-8-10-20(31)11-9-18/h3-11,13,15,24H,12,14H2,1-2H3,(H,32,33)(H,34,35) |
| InChIKey | NLHKZWUMUNUODH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.98 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|