C26H26FNO4 — CID 23606139
2-(3-tert-butyl-5-methyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[2-(2-fluorophenyl)ethyl]acetamide (PubChem CID 23606139) has the molecular formula C26H26FNO4 and a molecular weight of 435.50 g/mol. Its IUPAC name is 2-(3-tert-butyl-5-methyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[2-(2-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(3-tert-butyl-5-methyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[2-(2-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 23606139 |
| Molecular Formula | C26H26FNO4 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-(3-tert-butyl-5-methyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[2-(2-fluorophenyl)ethyl]acetamide |
| SMILES | Cc1c(CC(=O)NCCc2ccccc2F)c(=O)oc2cc3occ(C(C)(C)C)c3cc12 |
| InChI | InChI=1S/C26H26FNO4/c1-15-17-11-19-20(26(2,3)4)14-31-22(19)13-23(17)32-25(30)18(15)12-24(29)28-10-9-16-7-5-6-8-21(16)27/h5-8,11,13-14H,9-10,12H2,1-4H3,(H,28,29) |
| InChIKey | VGHKZCGXYNQRNX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|