C27H29NO5 — CID 23606150
2-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 23606150) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is 2-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[(2-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[(2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 23606150 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 2-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccccc1CNC(=O)Cc1c(C)c2cc3c(C(C)(C)C)coc3c(C)c2oc1=O |
| InChI | InChI=1S/C27H29NO5/c1-15-18-11-20-21(27(3,4)5)14-32-24(20)16(2)25(18)33-26(30)19(15)12-23(29)28-13-17-9-7-8-10-22(17)31-6/h7-11,14H,12-13H2,1-6H3,(H,28,29) |
| InChIKey | AVEGMLMKSJLODA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|