C10H9BrF3NO2 — CID 161189926
[(2R)-2-(4-bromophenyl)-1,1,1-trifluoropropan-2-yl]carbamic acid (PubChem CID 161189926) has the molecular formula C10H9BrF3NO2 and a molecular weight of 312.09 g/mol. Its IUPAC name is [(2R)-2-(4-bromophenyl)-1,1,1-trifluoropropan-2-yl]carbamic acid.
| Compound Name | [(2R)-2-(4-bromophenyl)-1,1,1-trifluoropropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 161189926 |
| Molecular Formula | C10H9BrF3NO2 |
| Molecular Weight | 312.09 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | [(2R)-2-(4-bromophenyl)-1,1,1-trifluoropropan-2-yl]carbamic acid |
| SMILES | C[C@@](NC(=O)O)(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H9BrF3NO2/c1-9(10(12,13)14,15-8(16)17)6-2-4-7(11)5-3-6/h2-5,15H,1H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | MOKHCCIJOXRRPY-SECBINFHSA-N |
| XLogP | 3.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.09 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |