C12H12BrF4NO — CID 103732827
N-[2-(4-bromophenyl)propan-2-yl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103732827) has the molecular formula C12H12BrF4NO and a molecular weight of 342.13 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)propan-2-yl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[2-(4-bromophenyl)propan-2-yl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103732827 |
| Molecular Formula | C12H12BrF4NO |
| Molecular Weight | 342.13 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | N-[2-(4-bromophenyl)propan-2-yl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | CC(C)(NC(=O)C(F)(F)C(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H12BrF4NO/c1-11(2,7-3-5-8(13)6-4-7)18-10(19)12(16,17)9(14)15/h3-6,9H,1-2H3,(H,18,19) |
| InChIKey | PYTPCRDBQOLAOT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.13 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|