C41H57ClN2O7S — CID 170540587
tert-butyl N-[(2R)-1-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethylamino]-1-oxo-3-tritylsulfanylpropan-2-yl]carbamate (PubChem CID 170540587) has the molecular formula C41H57ClN2O7S and a molecular weight of 757.43 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethylamino]-1-oxo-3-tritylsulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethylamino]-1-oxo-3-tritylsulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 170540587 |
| Molecular Formula | C41H57ClN2O7S |
| Molecular Weight | 757.43 g/mol |
| Exact Mass | 756.36 |
| IUPAC Name | tert-butyl N-[(2R)-1-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethylamino]-1-oxo-3-tritylsulfanylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NCCOCCOCCOCCOCCCCCCCl |
| InChI | InChI=1S/C41H57ClN2O7S/c1-40(2,3)51-39(46)44-37(38(45)43-24-26-48-28-30-50-32-31-49-29-27-47-25-16-5-4-15-23-42)33-52-41(34-17-9-6-10-18-34,35-19-11-7-12-20-35)36-21-13-8-14-22-36/h6-14,17-22,37H,4-5,15-16,23-33H2,1-3H3,(H,43,45)(H,44,46)/t37-/m0/s1 |
| InChIKey | GHXLONVVJIBZTQ-QNGWXLTQSA-N |
| XLogP | 7.59 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.43 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|