C46H48N2O8S — CID 167524849
[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]ethyl carbonate (PubChem CID 167524849) has the molecular formula C46H48N2O8S and a molecular weight of 788.96 g/mol. Its IUPAC name is [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]ethyl carbonate.
| Compound Name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]ethyl carbonate |
|---|---|
| PubChem CID | 167524849 |
| Molecular Formula | C46H48N2O8S |
| Molecular Weight | 788.96 g/mol |
| Exact Mass | 788.31 |
| IUPAC Name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]ethyl carbonate |
| SMILES | COc1cc(/C=C/c2ccc(OC(=O)OCCNC(=O)C(CSC(c3ccccc3)(c3ccccc3)c3ccccc3)NC(=O)OC(C)(C)C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C46H48N2O8S/c1-45(2,3)56-43(50)48-41(32-57-46(35-15-9-6-10-16-35,36-17-11-7-12-18-36)37-19-13-8-14-20-37)42(49)47-27-28-54-44(51)55-38-25-23-33(24-26-38)21-22-34-29-39(52-4)31-40(30-34)53-5/h6-26,29-31,41H,27-28,32H2,1-5H3,(H,47,49)(H,48,50)/b22-21+ |
| InChIKey | OJCDLJISBCHSSU-QURGRASLSA-N |
| XLogP | 9.12 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.96 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|