C40H47N3O10 — CID 175392716
tert-butyl 3-[3-[2-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]carbonyloxyethylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indole-1-carboxylate (PubChem CID 175392716) has the molecular formula C40H47N3O10 and a molecular weight of 729.83 g/mol. Its IUPAC name is tert-butyl 3-[3-[2-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]carbonyloxyethylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[3-[2-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]carbonyloxyethylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 175392716 |
| Molecular Formula | C40H47N3O10 |
| Molecular Weight | 729.83 g/mol |
| Exact Mass | 729.33 |
| IUPAC Name | tert-butyl 3-[3-[2-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]carbonyloxyethylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indole-1-carboxylate |
| SMILES | COc1cc(C=Cc2ccc(OC(=O)OCCNC(=O)C(Cc3cn(C(=O)OC(C)(C)C)c4ccccc34)NC(=O)OC(C)(C)C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C40H47N3O10/c1-39(2,3)52-36(45)42-33(23-28-25-43(37(46)53-40(4,5)6)34-12-10-9-11-32(28)34)35(44)41-19-20-50-38(47)51-29-17-15-26(16-18-29)13-14-27-21-30(48-7)24-31(22-27)49-8/h9-18,21-22,24-25,33H,19-20,23H2,1-8H3,(H,41,44)(H,42,45) |
| InChIKey | RQCQFKILMODTLF-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 152.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.83 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|