C30H40N2O8 — CID 166885285
[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 3-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]propyl carbonate (PubChem CID 166885285) has the molecular formula C30H40N2O8 and a molecular weight of 556.66 g/mol. Its IUPAC name is [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 3-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]propyl carbonate.
| Compound Name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 3-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]propyl carbonate |
|---|---|
| PubChem CID | 166885285 |
| Molecular Formula | C30H40N2O8 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 3-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]propyl carbonate |
| SMILES | COc1cc(/C=C/c2ccc(OC(=O)OCCCNC(=O)C(NC(=O)OC(C)(C)C)C(C)C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C30H40N2O8/c1-20(2)26(32-28(34)40-30(3,4)5)27(33)31-15-8-16-38-29(35)39-23-13-11-21(12-14-23)9-10-22-17-24(36-6)19-25(18-22)37-7/h9-14,17-20,26H,8,15-16H2,1-7H3,(H,31,33)(H,32,34)/b10-9+ |
| InChIKey | YCDYHKAKZABOST-MDZDMXLPSA-N |
| XLogP | 5.45 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|