C24H32N2O4S — CID 175392678
[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[(2-amino-3-methylbutyl)amino]ethylsulfanylformate (PubChem CID 175392678) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[(2-amino-3-methylbutyl)amino]ethylsulfanylformate.
| Compound Name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[(2-amino-3-methylbutyl)amino]ethylsulfanylformate |
|---|---|
| PubChem CID | 175392678 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[(2-amino-3-methylbutyl)amino]ethylsulfanylformate |
| SMILES | COc1cc(/C=C/c2ccc(OC(=O)SCCNCC(N)C(C)C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C24H32N2O4S/c1-17(2)23(25)16-26-11-12-31-24(27)30-20-9-7-18(8-10-20)5-6-19-13-21(28-3)15-22(14-19)29-4/h5-10,13-15,17,23,26H,11-12,16,25H2,1-4H3/b6-5+ |
| InChIKey | KETQHIXWGLQPEN-AATRIKPKSA-N |
| XLogP | 4.68 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|