C19H15F5O4 — CID 91744795
[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91744795) has the molecular formula C19H15F5O4 and a molecular weight of 402.32 g/mol. Its IUPAC name is [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91744795 |
| Molecular Formula | C19H15F5O4 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | COc1cc(/C=C/c2ccc(OC(=O)C(F)(F)C(F)(F)F)cc2)cc(OC)c1 |
| InChI | InChI=1S/C19H15F5O4/c1-26-15-9-13(10-16(11-15)27-2)4-3-12-5-7-14(8-6-12)28-17(25)18(20,21)19(22,23)24/h3-11H,1-2H3/b4-3+ |
| InChIKey | VZWZCMZUTWHOTM-ONEGZZNKSA-N |
| XLogP | 4.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|