C23H29NO4 — CID 78127654
[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] N,N-di(propan-2-yl)carbamate (PubChem CID 78127654) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is [4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 78127654 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | [4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] N,N-di(propan-2-yl)carbamate |
| SMILES | COc1cc(C=Cc2ccc(OC(=O)N(C(C)C)C(C)C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C23H29NO4/c1-16(2)24(17(3)4)23(25)28-20-11-9-18(10-12-20)7-8-19-13-21(26-5)15-22(14-19)27-6/h7-17H,1-6H3 |
| InChIKey | XNEVUJMWBAXDJE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|