C17H17NO4 — CID 174666755
[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] carbamate (PubChem CID 174666755) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is [4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] carbamate.
| Compound Name | [4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] carbamate |
|---|---|
| PubChem CID | 174666755 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | [4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] carbamate |
| SMILES | COc1cc(C=Cc2ccc(OC(N)=O)cc2)cc(OC)c1 |
| InChI | InChI=1S/C17H17NO4/c1-20-15-9-13(10-16(11-15)21-2)4-3-12-5-7-14(8-6-12)22-17(18)19/h3-11H,1-2H3,(H2,18,19) |
| InChIKey | FLCWIDIMFGQMBN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|