C31H38O9 — CID 123230166
[4-[2-[3-methoxy-5-(2,2,5-trimethyl-1,3-dioxane-5-carbonyl)oxyphenyl]ethenyl]phenyl] 2,2,5-trimethyl-1,3-dioxane-5-carboxylate (PubChem CID 123230166) has the molecular formula C31H38O9 and a molecular weight of 554.64 g/mol. Its IUPAC name is [4-[2-[3-methoxy-5-(2,2,5-trimethyl-1,3-dioxane-5-carbonyl)oxyphenyl]ethenyl]phenyl] 2,2,5-trimethyl-1,3-dioxane-5-carboxylate.
| Compound Name | [4-[2-[3-methoxy-5-(2,2,5-trimethyl-1,3-dioxane-5-carbonyl)oxyphenyl]ethenyl]phenyl] 2,2,5-trimethyl-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 123230166 |
| Molecular Formula | C31H38O9 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | [4-[2-[3-methoxy-5-(2,2,5-trimethyl-1,3-dioxane-5-carbonyl)oxyphenyl]ethenyl]phenyl] 2,2,5-trimethyl-1,3-dioxane-5-carboxylate |
| SMILES | COc1cc(C=Cc2ccc(OC(=O)C3(C)COC(C)(C)OC3)cc2)cc(OC(=O)C2(C)COC(C)(C)OC2)c1 |
| InChI | InChI=1S/C31H38O9/c1-28(2)35-17-30(5,18-36-28)26(32)39-23-12-10-21(11-13-23)8-9-22-14-24(34-7)16-25(15-22)40-27(33)31(6)19-37-29(3,4)38-20-31/h8-16H,17-20H2,1-7H3 |
| InChIKey | HIACKZOWBVYBSX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|