C18H8F10O6S — CID 91741062
[4-[4-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl]sulfonylphenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91741062) has the molecular formula C18H8F10O6S and a molecular weight of 542.30 g/mol. Its IUPAC name is [4-[4-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl]sulfonylphenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [4-[4-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl]sulfonylphenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91741062 |
| Molecular Formula | C18H8F10O6S |
| Molecular Weight | 542.30 g/mol |
| Exact Mass | 541.99 |
| IUPAC Name | [4-[4-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl]sulfonylphenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(Oc1ccc(S(=O)(=O)c2ccc(OC(=O)C(F)(F)C(F)(F)F)cc2)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H8F10O6S/c19-15(20,17(23,24)25)13(29)33-9-1-5-11(6-2-9)35(31,32)12-7-3-10(4-8-12)34-14(30)16(21,22)18(26,27)28/h1-8H |
| InChIKey | OHHQHNJYZJQZMP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|