C14H3F13O5 — CID 91748761
[4-(2,2,3,3,3-pentafluoropropanoyloxy)-3-(2,2,2-trifluoroacetyl)phenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91748761) has the molecular formula C14H3F13O5 and a molecular weight of 498.15 g/mol. Its IUPAC name is [4-(2,2,3,3,3-pentafluoropropanoyloxy)-3-(2,2,2-trifluoroacetyl)phenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [4-(2,2,3,3,3-pentafluoropropanoyloxy)-3-(2,2,2-trifluoroacetyl)phenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91748761 |
| Molecular Formula | C14H3F13O5 |
| Molecular Weight | 498.15 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | [4-(2,2,3,3,3-pentafluoropropanoyloxy)-3-(2,2,2-trifluoroacetyl)phenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(c1cc(OC(=O)C(F)(F)C(F)(F)F)ccc1OC(=O)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H3F13O5/c15-10(16,13(22,23)24)8(29)31-4-1-2-6(5(3-4)7(28)12(19,20)21)32-9(30)11(17,18)14(25,26)27/h1-3H |
| InChIKey | VSBOBVMCUQMIIU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.15 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|