C10H6F6O3 — CID 91717601
(4-fluoro-2-methoxyphenyl) 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91717601) has the molecular formula C10H6F6O3 and a molecular weight of 288.14 g/mol. Its IUPAC name is (4-fluoro-2-methoxyphenyl) 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | (4-fluoro-2-methoxyphenyl) 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91717601 |
| Molecular Formula | C10H6F6O3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | (4-fluoro-2-methoxyphenyl) 2,2,3,3,3-pentafluoropropanoate |
| SMILES | COc1cc(F)ccc1OC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F6O3/c1-18-7-4-5(11)2-3-6(7)19-8(17)9(12,13)10(14,15)16/h2-4H,1H3 |
| InChIKey | MDRRZNHGHPMQJH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|